C18H20ClN5O3 — CID 133359516
3-(4-chloro-2-nitroanilino)-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 133359516) has the molecular formula C18H20ClN5O3 and a molecular weight of 389.84 g/mol. Its IUPAC name is 3-(4-chloro-2-nitroanilino)-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-(4-chloro-2-nitroanilino)-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 133359516 |
| Molecular Formula | C18H20ClN5O3 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-(4-chloro-2-nitroanilino)-1-(4-pyridin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | O=C(CCNc1ccc(Cl)cc1[N+](=O)[O-])N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H20ClN5O3/c19-14-4-5-15(16(13-14)24(26)27)20-8-6-18(25)23-11-9-22(10-12-23)17-3-1-2-7-21-17/h1-5,7,13,20H,6,8-12H2 |
| InChIKey | RUSNORQFJIVODI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|