C17H18Cl2N4O4 — CID 133380310
[4-[(4,5-dichloro-1-methylpyrrol-2-yl)methylamino]-3-nitrophenyl]-morpholin-4-ylmethanone (PubChem CID 133380310) has the molecular formula C17H18Cl2N4O4 and a molecular weight of 413.26 g/mol. Its IUPAC name is [4-[(4,5-dichloro-1-methylpyrrol-2-yl)methylamino]-3-nitrophenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(4,5-dichloro-1-methylpyrrol-2-yl)methylamino]-3-nitrophenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133380310 |
| Molecular Formula | C17H18Cl2N4O4 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | [4-[(4,5-dichloro-1-methylpyrrol-2-yl)methylamino]-3-nitrophenyl]-morpholin-4-ylmethanone |
| SMILES | Cn1c(CNc2ccc(C(=O)N3CCOCC3)cc2[N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C17H18Cl2N4O4/c1-21-12(9-13(18)16(21)19)10-20-14-3-2-11(8-15(14)23(25)26)17(24)22-4-6-27-7-5-22/h2-3,8-9,20H,4-7,10H2,1H3 |
| InChIKey | HNORRNVYOGUXIB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|