C19H27N3O5 — CID 133344068
[4-[(2-hydroxy-1-methylcyclohexyl)methylamino]-3-nitrophenyl]-morpholin-4-ylmethanone (PubChem CID 133344068) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-[(2-hydroxy-1-methylcyclohexyl)methylamino]-3-nitrophenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(2-hydroxy-1-methylcyclohexyl)methylamino]-3-nitrophenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133344068 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [4-[(2-hydroxy-1-methylcyclohexyl)methylamino]-3-nitrophenyl]-morpholin-4-ylmethanone |
| SMILES | CC1(CNc2ccc(C(=O)N3CCOCC3)cc2[N+](=O)[O-])CCCCC1O |
| InChI | InChI=1S/C19H27N3O5/c1-19(7-3-2-4-17(19)23)13-20-15-6-5-14(12-16(15)22(25)26)18(24)21-8-10-27-11-9-21/h5-6,12,17,20,23H,2-4,7-11,13H2,1H3 |
| InChIKey | JSDWLOXVQILHOW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|