C21H32N4O4 — CID 133309723
[4-[1-(3,5-dimethylpiperidin-1-yl)propan-2-ylamino]-3-nitrophenyl]-morpholin-4-ylmethanone (PubChem CID 133309723) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is [4-[1-(3,5-dimethylpiperidin-1-yl)propan-2-ylamino]-3-nitrophenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[1-(3,5-dimethylpiperidin-1-yl)propan-2-ylamino]-3-nitrophenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 133309723 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | [4-[1-(3,5-dimethylpiperidin-1-yl)propan-2-ylamino]-3-nitrophenyl]-morpholin-4-ylmethanone |
| SMILES | CC1CC(C)CN(CC(C)Nc2ccc(C(=O)N3CCOCC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H32N4O4/c1-15-10-16(2)13-23(12-15)14-17(3)22-19-5-4-18(11-20(19)25(27)28)21(26)24-6-8-29-9-7-24/h4-5,11,15-17,22H,6-10,12-14H2,1-3H3 |
| InChIKey | CCSZRZLGKDVECM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|