C18H28N4O5 — CID 133309693
[4-[1-(3,5-dimethylpiperidin-1-yl)propan-2-ylamino]-2-methyl-3,5-dinitrophenyl]methanol (PubChem CID 133309693) has the molecular formula C18H28N4O5 and a molecular weight of 380.45 g/mol. Its IUPAC name is [4-[1-(3,5-dimethylpiperidin-1-yl)propan-2-ylamino]-2-methyl-3,5-dinitrophenyl]methanol.
| Compound Name | [4-[1-(3,5-dimethylpiperidin-1-yl)propan-2-ylamino]-2-methyl-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 133309693 |
| Molecular Formula | C18H28N4O5 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [4-[1-(3,5-dimethylpiperidin-1-yl)propan-2-ylamino]-2-methyl-3,5-dinitrophenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(NC(C)CN2CC(C)CC(C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H28N4O5/c1-11-5-12(2)8-20(7-11)9-13(3)19-17-16(21(24)25)6-15(10-23)14(4)18(17)22(26)27/h6,11-13,19,23H,5,7-10H2,1-4H3 |
| InChIKey | SLDPGFMELCYZSV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|