C13H19N3O6S — CID 23335968
3-methyl-4-methylsulfonyl-2,6-dinitro-N-pentan-2-ylaniline (PubChem CID 23335968) has the molecular formula C13H19N3O6S and a molecular weight of 345.38 g/mol. Its IUPAC name is 3-methyl-4-methylsulfonyl-2,6-dinitro-N-pentan-2-ylaniline.
| Compound Name | 3-methyl-4-methylsulfonyl-2,6-dinitro-N-pentan-2-ylaniline |
|---|---|
| PubChem CID | 23335968 |
| Molecular Formula | C13H19N3O6S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-methyl-4-methylsulfonyl-2,6-dinitro-N-pentan-2-ylaniline |
| SMILES | CCCC(C)Nc1c([N+](=O)[O-])cc(S(C)(=O)=O)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O6S/c1-5-6-8(2)14-12-10(15(17)18)7-11(23(4,21)22)9(3)13(12)16(19)20/h7-8,14H,5-6H2,1-4H3 |
| InChIKey | SCJUUEJQFDDYEG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|