C13H19N3O5 — CID 533681
[2-methyl-3,5-dinitro-4-(pentan-3-ylamino)phenyl]methanol (PubChem CID 533681) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is [2-methyl-3,5-dinitro-4-(pentan-3-ylamino)phenyl]methanol.
| Compound Name | [2-methyl-3,5-dinitro-4-(pentan-3-ylamino)phenyl]methanol |
|---|---|
| PubChem CID | 533681 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | [2-methyl-3,5-dinitro-4-(pentan-3-ylamino)phenyl]methanol |
| SMILES | CCC(CC)Nc1c([N+](=O)[O-])cc(CO)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N3O5/c1-4-10(5-2)14-12-11(15(18)19)6-9(7-17)8(3)13(12)16(20)21/h6,10,14,17H,4-5,7H2,1-3H3 |
| InChIKey | JXPNNQHCFMKVHK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|