C12H14N6O5 — CID 133332026
[2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylamino]-3,5-dinitrophenyl]methanol (PubChem CID 133332026) has the molecular formula C12H14N6O5 and a molecular weight of 322.28 g/mol. Its IUPAC name is [2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylamino]-3,5-dinitrophenyl]methanol.
| Compound Name | [2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylamino]-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 133332026 |
| Molecular Formula | C12H14N6O5 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | [2-methyl-4-[(2-methyl-1,2,4-triazol-3-yl)methylamino]-3,5-dinitrophenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(NCc2ncnn2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N6O5/c1-7-8(5-19)3-9(17(20)21)11(12(7)18(22)23)13-4-10-14-6-15-16(10)2/h3,6,13,19H,4-5H2,1-2H3 |
| InChIKey | SSIYANLAKMYEGJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 149.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|