C16H14BrN5O5 — CID 133269823
[4-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylamino]-2-methyl-3,5-dinitrophenyl]methanol (PubChem CID 133269823) has the molecular formula C16H14BrN5O5 and a molecular weight of 436.22 g/mol. Its IUPAC name is [4-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylamino]-2-methyl-3,5-dinitrophenyl]methanol.
| Compound Name | [4-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylamino]-2-methyl-3,5-dinitrophenyl]methanol |
|---|---|
| PubChem CID | 133269823 |
| Molecular Formula | C16H14BrN5O5 |
| Molecular Weight | 436.22 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | [4-[(6-bromoimidazo[1,2-a]pyridin-2-yl)methylamino]-2-methyl-3,5-dinitrophenyl]methanol |
| SMILES | Cc1c(CO)cc([N+](=O)[O-])c(NCc2cn3cc(Br)ccc3n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14BrN5O5/c1-9-10(8-23)4-13(21(24)25)15(16(9)22(26)27)18-5-12-7-20-6-11(17)2-3-14(20)19-12/h2-4,6-7,18,23H,5,8H2,1H3 |
| InChIKey | OEPCBYMYHFCNRL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|