C13H11ClN4O4S2 — CID 133440796
N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine (PubChem CID 133440796) has the molecular formula C13H11ClN4O4S2 and a molecular weight of 386.84 g/mol. Its IUPAC name is N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine.
| Compound Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 133440796 |
| Molecular Formula | C13H11ClN4O4S2 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | N-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl]-5-methylsulfonyl-3-nitrothiophen-2-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NCc2cn3cc(Cl)ccc3n2)s1 |
| InChI | InChI=1S/C13H11ClN4O4S2/c1-24(21,22)12-4-10(18(19)20)13(23-12)15-5-9-7-17-6-8(14)2-3-11(17)16-9/h2-4,6-7,15H,5H2,1H3 |
| InChIKey | SURAAAOHQGHRJV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|