C15H10ClN5O2 — CID 134017959
4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-3-nitrobenzonitrile (PubChem CID 134017959) has the molecular formula C15H10ClN5O2 and a molecular weight of 327.73 g/mol. Its IUPAC name is 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-3-nitrobenzonitrile.
| Compound Name | 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 134017959 |
| Molecular Formula | C15H10ClN5O2 |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methylamino]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(NCc2cn3cc(Cl)ccc3n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10ClN5O2/c16-11-2-4-15-19-12(9-20(15)8-11)7-18-13-3-1-10(6-17)5-14(13)21(22)23/h1-5,8-9,18H,7H2 |
| InChIKey | LIHCKRLGMNJKDQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|