C13H12N4O5S2 — CID 133453437
5-[[(5-methylsulfonyl-3-nitrothiophen-2-yl)amino]methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 133453437) has the molecular formula C13H12N4O5S2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 5-[[(5-methylsulfonyl-3-nitrothiophen-2-yl)amino]methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[[(5-methylsulfonyl-3-nitrothiophen-2-yl)amino]methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 133453437 |
| Molecular Formula | C13H12N4O5S2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 5-[[(5-methylsulfonyl-3-nitrothiophen-2-yl)amino]methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NCc2ccc3[nH]c(=O)[nH]c3c2)s1 |
| InChI | InChI=1S/C13H12N4O5S2/c1-24(21,22)11-5-10(17(19)20)12(23-11)14-6-7-2-3-8-9(4-7)16-13(18)15-8/h2-5,14H,6H2,1H3,(H2,15,16,18) |
| InChIKey | ODXVSARDGZZMRL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|