C9H12N4O3S — CID 22745215
5-[(methylsulfamoylamino)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 22745215) has the molecular formula C9H12N4O3S and a molecular weight of 256.29 g/mol. Its IUPAC name is 5-[(methylsulfamoylamino)methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(methylsulfamoylamino)methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 22745215 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-[(methylsulfamoylamino)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CNS(=O)(=O)NCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H12N4O3S/c1-10-17(15,16)11-5-6-2-3-7-8(4-6)13-9(14)12-7/h2-4,10-11H,5H2,1H3,(H2,12,13,14) |
| InChIKey | MJOHMSUPXPCPMM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |