C9H12N4O — CID 115225769
5-[(aminomethylamino)methyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 115225769) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 5-[(aminomethylamino)methyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(aminomethylamino)methyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 115225769 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 5-[(aminomethylamino)methyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | NCNCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C9H12N4O/c10-5-11-4-6-1-2-7-8(3-6)13-9(14)12-7/h1-3,11H,4-5,10H2,(H2,12,13,14) |
| InChIKey | HCBJIGJBIHHTGN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|