C16H16N4O2 — CID 110775421
1-benzyl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]urea (PubChem CID 110775421) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-benzyl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]urea.
| Compound Name | 1-benzyl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]urea |
|---|---|
| PubChem CID | 110775421 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-benzyl-3-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]urea |
| SMILES | O=C(NCc1ccccc1)NCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H16N4O2/c21-15(17-9-11-4-2-1-3-5-11)18-10-12-6-7-13-14(8-12)20-16(22)19-13/h1-8H,9-10H2,(H2,17,18,21)(H2,19,20,22) |
| InChIKey | AQQRIVSJIYGKSF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |