C16H16N4O — CID 155113900
5-[1-(benzylamino)ethenylamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 155113900) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-[1-(benzylamino)ethenylamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[1-(benzylamino)ethenylamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 155113900 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-[1-(benzylamino)ethenylamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | C=C(NCc1ccccc1)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H16N4O/c1-11(17-10-12-5-3-2-4-6-12)18-13-7-8-14-15(9-13)20-16(21)19-14/h2-9,17-18H,1,10H2,(H2,19,20,21) |
| InChIKey | PXMJALCTLFFSMT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |