C17H21N3O5S2 — CID 133440559
5-methylsulfonyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-nitrothiophen-2-amine (PubChem CID 133440559) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 5-methylsulfonyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-nitrothiophen-2-amine.
| Compound Name | 5-methylsulfonyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 133440559 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 5-methylsulfonyl-N-[[2-(morpholin-4-ylmethyl)phenyl]methyl]-3-nitrothiophen-2-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NCc2ccccc2CN2CCOCC2)s1 |
| InChI | InChI=1S/C17H21N3O5S2/c1-27(23,24)16-10-15(20(21)22)17(26-16)18-11-13-4-2-3-5-14(13)12-19-6-8-25-9-7-19/h2-5,10,18H,6-9,11-12H2,1H3 |
| InChIKey | YIFSJGHRJZHCPA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|