C15H19N3O5S3 — CID 97253849
5-methylsulfonyl-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-3-nitrothiophen-2-amine (PubChem CID 97253849) has the molecular formula C15H19N3O5S3 and a molecular weight of 417.53 g/mol. Its IUPAC name is 5-methylsulfonyl-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-3-nitrothiophen-2-amine.
| Compound Name | 5-methylsulfonyl-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-3-nitrothiophen-2-amine |
|---|---|
| PubChem CID | 97253849 |
| Molecular Formula | C15H19N3O5S3 |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 5-methylsulfonyl-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-3-nitrothiophen-2-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NC[C@@H](c2cccs2)N2CCOCC2)s1 |
| InChI | InChI=1S/C15H19N3O5S3/c1-26(21,22)14-9-11(18(19)20)15(25-14)16-10-12(13-3-2-8-24-13)17-4-6-23-7-5-17/h2-3,8-9,12,16H,4-7,10H2,1H3/t12-/m0/s1 |
| InChIKey | QIHVGCPJZGSIJY-LBPRGKRZSA-N |
| XLogP | 2.61 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|