C13H17N3O5S2 — CID 133423564
1-(furan-2-yl)-N,N-dimethyl-N'-(5-methylsulfonyl-3-nitrothiophen-2-yl)ethane-1,2-diamine (PubChem CID 133423564) has the molecular formula C13H17N3O5S2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-(furan-2-yl)-N,N-dimethyl-N'-(5-methylsulfonyl-3-nitrothiophen-2-yl)ethane-1,2-diamine.
| Compound Name | 1-(furan-2-yl)-N,N-dimethyl-N'-(5-methylsulfonyl-3-nitrothiophen-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133423564 |
| Molecular Formula | C13H17N3O5S2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-(furan-2-yl)-N,N-dimethyl-N'-(5-methylsulfonyl-3-nitrothiophen-2-yl)ethane-1,2-diamine |
| SMILES | CN(C)C(CNc1sc(S(C)(=O)=O)cc1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C13H17N3O5S2/c1-15(2)10(11-5-4-6-21-11)8-14-13-9(16(17)18)7-12(22-13)23(3,19)20/h4-7,10,14H,8H2,1-3H3 |
| InChIKey | NAJLFBSMLJBCDB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|