C15H19N3O4S3 — CID 133424190
5-methylsulfonyl-3-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)thiophen-2-amine (PubChem CID 133424190) has the molecular formula C15H19N3O4S3 and a molecular weight of 401.54 g/mol. Its IUPAC name is 5-methylsulfonyl-3-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)thiophen-2-amine.
| Compound Name | 5-methylsulfonyl-3-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)thiophen-2-amine |
|---|---|
| PubChem CID | 133424190 |
| Molecular Formula | C15H19N3O4S3 |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 5-methylsulfonyl-3-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)thiophen-2-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NCC(c2cccs2)N2CCCC2)s1 |
| InChI | InChI=1S/C15H19N3O4S3/c1-25(21,22)14-9-11(18(19)20)15(24-14)16-10-12(13-5-4-8-23-13)17-6-2-3-7-17/h4-5,8-9,12,16H,2-3,6-7,10H2,1H3 |
| InChIKey | MADOOMWFCZSBHE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|