C11H13N3O4S2 — CID 75476733
5-methylsulfonyl-3-nitro-N-[2-(1H-pyrrol-2-yl)ethyl]thiophen-2-amine (PubChem CID 75476733) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 5-methylsulfonyl-3-nitro-N-[2-(1H-pyrrol-2-yl)ethyl]thiophen-2-amine.
| Compound Name | 5-methylsulfonyl-3-nitro-N-[2-(1H-pyrrol-2-yl)ethyl]thiophen-2-amine |
|---|---|
| PubChem CID | 75476733 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 5-methylsulfonyl-3-nitro-N-[2-(1H-pyrrol-2-yl)ethyl]thiophen-2-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NCCc2ccc[nH]2)s1 |
| InChI | InChI=1S/C11H13N3O4S2/c1-20(17,18)10-7-9(14(15)16)11(19-10)13-6-4-8-3-2-5-12-8/h2-3,5,7,12-13H,4,6H2,1H3 |
| InChIKey | RIFINZRLZDZWMT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 105.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|