C11H10F3N3O4S3 — CID 133423768
5-methylsulfonyl-3-nitro-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiophen-2-amine (PubChem CID 133423768) has the molecular formula C11H10F3N3O4S3 and a molecular weight of 401.41 g/mol. Its IUPAC name is 5-methylsulfonyl-3-nitro-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiophen-2-amine.
| Compound Name | 5-methylsulfonyl-3-nitro-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiophen-2-amine |
|---|---|
| PubChem CID | 133423768 |
| Molecular Formula | C11H10F3N3O4S3 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | 5-methylsulfonyl-3-nitro-N-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]thiophen-2-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NCCc2nc(C(F)(F)F)cs2)s1 |
| InChI | InChI=1S/C11H10F3N3O4S3/c1-24(20,21)9-4-6(17(18)19)10(23-9)15-3-2-8-16-7(5-22-8)11(12,13)14/h4-5,15H,2-3H2,1H3 |
| InChIKey | ZDAYZXRTOCUTBT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|