C13H18F3N3O4S2 — CID 133486795
5-methylsulfonyl-3-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]thiophen-2-amine (PubChem CID 133486795) has the molecular formula C13H18F3N3O4S2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 5-methylsulfonyl-3-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]thiophen-2-amine.
| Compound Name | 5-methylsulfonyl-3-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]thiophen-2-amine |
|---|---|
| PubChem CID | 133486795 |
| Molecular Formula | C13H18F3N3O4S2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 5-methylsulfonyl-3-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]thiophen-2-amine |
| SMILES | CS(=O)(=O)c1cc([N+](=O)[O-])c(NCC2CCN(CC(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C13H18F3N3O4S2/c1-25(22,23)11-6-10(19(20)21)12(24-11)17-7-9-2-4-18(5-3-9)8-13(14,15)16/h6,9,17H,2-5,7-8H2,1H3 |
| InChIKey | PSVJHCZCLHOINO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|