C12H17F3N6O2 — CID 133486624
5-nitro-2-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]pyrimidine-2,4-diamine (PubChem CID 133486624) has the molecular formula C12H17F3N6O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 5-nitro-2-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133486624 |
| Molecular Formula | C12H17F3N6O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-nitro-2-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCC2CCN(CC(F)(F)F)CC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17F3N6O2/c13-12(14,15)7-20-3-1-8(2-4-20)5-17-11-18-6-9(21(22)23)10(16)19-11/h6,8H,1-5,7H2,(H3,16,17,18,19) |
| InChIKey | XSJXYSRLIDGBRD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|