C14H18F3N5O3 — CID 133486819
5-nitro-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methylamino]pyridine-3-carboxamide (PubChem CID 133486819) has the molecular formula C14H18F3N5O3 and a molecular weight of 361.32 g/mol. Its IUPAC name is 5-nitro-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methylamino]pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133486819 |
| Molecular Formula | C14H18F3N5O3 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 5-nitro-2-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methylamino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cnc1NCC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H18F3N5O3/c15-14(16,17)8-21-3-1-9(2-4-21)6-19-13-11(12(18)23)5-10(7-20-13)22(24)25/h5,7,9H,1-4,6,8H2,(H2,18,23)(H,19,20) |
| InChIKey | RPPDAUNICFPYAF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|