C14H16N4O3 — CID 133365583
5-nitro-2-(3-tricyclo[3.2.1.02,4]octanylamino)pyridine-3-carboxamide (PubChem CID 133365583) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 5-nitro-2-(3-tricyclo[3.2.1.02,4]octanylamino)pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-(3-tricyclo[3.2.1.02,4]octanylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133365583 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-nitro-2-(3-tricyclo[3.2.1.02,4]octanylamino)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cnc1NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C14H16N4O3/c15-13(19)9-4-8(18(20)21)5-16-14(9)17-12-10-6-1-2-7(3-6)11(10)12/h4-7,10-12H,1-3H2,(H2,15,19)(H,16,17) |
| InChIKey | CNVQFVBBGSCPGC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|