C17H17F3N6O3 — CID 47054080
5-nitro-2-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]pyridine-3-carboxamide (PubChem CID 47054080) has the molecular formula C17H17F3N6O3 and a molecular weight of 410.36 g/mol. Its IUPAC name is 5-nitro-2-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]pyridine-3-carboxamide.
| Compound Name | 5-nitro-2-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 47054080 |
| Molecular Formula | C17H17F3N6O3 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 5-nitro-2-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cnc1NC1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H17F3N6O3/c18-17(19,20)10-1-2-14(22-8-10)25-5-3-11(4-6-25)24-16-13(15(21)27)7-12(9-23-16)26(28)29/h1-2,7-9,11H,3-6H2,(H2,21,27)(H,23,24) |
| InChIKey | JYWVHUFKJSLTPA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|