C19H18F3N3O3 — CID 120549268
3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamoyl]benzoic acid (PubChem CID 120549268) has the molecular formula C19H18F3N3O3 and a molecular weight of 393.37 g/mol. Its IUPAC name is 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamoyl]benzoic acid.
| Compound Name | 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 120549268 |
| Molecular Formula | C19H18F3N3O3 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C(=O)NC2CCN(c3ccc(C(F)(F)F)cn3)CC2)c1 |
| InChI | InChI=1S/C19H18F3N3O3/c20-19(21,22)14-4-5-16(23-11-14)25-8-6-15(7-9-25)24-17(26)12-2-1-3-13(10-12)18(27)28/h1-5,10-11,15H,6-9H2,(H,24,26)(H,27,28) |
| InChIKey | ISAQGRHIPOXGLC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |