C19H17F6N3O — CID 46475049
4-(trifluoromethyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide (PubChem CID 46475049) has the molecular formula C19H17F6N3O and a molecular weight of 417.35 g/mol. Its IUPAC name is 4-(trifluoromethyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide.
| Compound Name | 4-(trifluoromethyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46475049 |
| Molecular Formula | C19H17F6N3O |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 4-(trifluoromethyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(c2ccc(C(F)(F)F)cn2)CC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F6N3O/c20-18(21,22)13-3-1-12(2-4-13)17(29)27-15-7-9-28(10-8-15)16-6-5-14(11-26-16)19(23,24)25/h1-6,11,15H,7-10H2,(H,27,29) |
| InChIKey | LGKHDXFCXXJKIL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |