C18H16BrF4N3O — CID 46466116
2-bromo-5-fluoro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide (PubChem CID 46466116) has the molecular formula C18H16BrF4N3O and a molecular weight of 446.24 g/mol. Its IUPAC name is 2-bromo-5-fluoro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide.
| Compound Name | 2-bromo-5-fluoro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 46466116 |
| Molecular Formula | C18H16BrF4N3O |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 2-bromo-5-fluoro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(c2ccc(C(F)(F)F)cn2)CC1)c1cc(F)ccc1Br |
| InChI | InChI=1S/C18H16BrF4N3O/c19-15-3-2-12(20)9-14(15)17(27)25-13-5-7-26(8-6-13)16-4-1-11(10-24-16)18(21,22)23/h1-4,9-10,13H,5-8H2,(H,25,27) |
| InChIKey | FYDGNXWAXRJHRK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |