C18H15ClF5N3O — CID 55708556
2-chloro-4,5-difluoro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide (PubChem CID 55708556) has the molecular formula C18H15ClF5N3O and a molecular weight of 419.78 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55708556 |
| Molecular Formula | C18H15ClF5N3O |
| Molecular Weight | 419.78 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(c2ccc(C(F)(F)F)cn2)CC1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C18H15ClF5N3O/c19-13-8-15(21)14(20)7-12(13)17(28)26-11-3-5-27(6-4-11)16-2-1-10(9-25-16)18(22,23)24/h1-2,7-9,11H,3-6H2,(H,26,28) |
| InChIKey | GJIDIMDOTFZWKX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.78 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|