C15H13ClF3N3OS — CID 121142594
5-chloro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 121142594) has the molecular formula C15H13ClF3N3OS and a molecular weight of 375.80 g/mol. Its IUPAC name is 5-chloro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 121142594 |
| Molecular Formula | C15H13ClF3N3OS |
| Molecular Weight | 375.80 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 5-chloro-N-[1-[5-(trifluoromethyl)-2-pyridinyl]pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(c2ccc(C(F)(F)F)cn2)C1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H13ClF3N3OS/c16-12-3-2-11(24-12)14(23)21-10-5-6-22(8-10)13-4-1-9(7-20-13)15(17,18)19/h1-4,7,10H,5-6,8H2,(H,21,23) |
| InChIKey | QLEPUAFDKLERTM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.80 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |