C21H21ClF3N3O — CID 55708616
(E)-3-(3-chloro-4-methylphenyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]prop-2-enamide (PubChem CID 55708616) has the molecular formula C21H21ClF3N3O and a molecular weight of 423.87 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-methylphenyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-methylphenyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55708616 |
| Molecular Formula | C21H21ClF3N3O |
| Molecular Weight | 423.87 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | (E)-3-(3-chloro-4-methylphenyl)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC2CCN(c3ccc(C(F)(F)F)cn3)CC2)cc1Cl |
| InChI | InChI=1S/C21H21ClF3N3O/c1-14-2-3-15(12-18(14)22)4-7-20(29)27-17-8-10-28(11-9-17)19-6-5-16(13-26-19)21(23,24)25/h2-7,12-13,17H,8-11H2,1H3,(H,27,29)/b7-4+ |
| InChIKey | FOSLEJAILIHZEX-QPJJXVBHSA-N |
| XLogP | 4.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|