C21H20F5N3O2 — CID 55708638
3-[2-(difluoromethoxy)phenyl]-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]prop-2-enamide (PubChem CID 55708638) has the molecular formula C21H20F5N3O2 and a molecular weight of 441.40 g/mol. Its IUPAC name is 3-[2-(difluoromethoxy)phenyl]-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]prop-2-enamide.
| Compound Name | 3-[2-(difluoromethoxy)phenyl]-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 55708638 |
| Molecular Formula | C21H20F5N3O2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 3-[2-(difluoromethoxy)phenyl]-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1OC(F)F)NC1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C21H20F5N3O2/c22-20(23)31-17-4-2-1-3-14(17)5-8-19(30)28-16-9-11-29(12-10-16)18-7-6-15(13-27-18)21(24,25)26/h1-8,13,16,20H,9-12H2,(H,28,30) |
| InChIKey | WCURPKSPWVNMFJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|