C23H28F3N3O2 — CID 55708412
2-(4-tert-butylphenoxy)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]acetamide (PubChem CID 55708412) has the molecular formula C23H28F3N3O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]acetamide.
| Compound Name | 2-(4-tert-butylphenoxy)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 55708412 |
| Molecular Formula | C23H28F3N3O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-N-[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]acetamide |
| SMILES | CC(C)(C)c1ccc(OCC(=O)NC2CCN(c3ccc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C23H28F3N3O2/c1-22(2,3)16-4-7-19(8-5-16)31-15-21(30)28-18-10-12-29(13-11-18)20-9-6-17(14-27-20)23(24,25)26/h4-9,14,18H,10-13,15H2,1-3H3,(H,28,30) |
| InChIKey | LVNUNHSXUNNDBU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |