C19H16Cl2F3N3O — CID 26900143
(E)-3-(3,4-dichlorophenyl)-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 26900143) has the molecular formula C19H16Cl2F3N3O and a molecular weight of 430.26 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26900143 |
| Molecular Formula | C19H16Cl2F3N3O |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C19H16Cl2F3N3O/c20-15-4-1-13(11-16(15)21)2-6-18(28)27-9-7-26(8-10-27)17-5-3-14(12-25-17)19(22,23)24/h1-6,11-12H,7-10H2/b6-2+ |
| InChIKey | VRVWCOAGJZLPSG-QHHAFSJGSA-N |
| XLogP | 4.77 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|