C17H15BrF3N3O2 — CID 26661653
(E)-3-(5-bromofuran-2-yl)-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 26661653) has the molecular formula C17H15BrF3N3O2 and a molecular weight of 430.22 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26661653 |
| Molecular Formula | C17H15BrF3N3O2 |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-1-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(Br)o1)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H15BrF3N3O2/c18-14-4-2-13(26-14)3-6-16(25)24-9-7-23(8-10-24)15-5-1-12(11-22-15)17(19,20)21/h1-6,11H,7-10H2/b6-3+ |
| InChIKey | WIERGFZMADOMKY-ZZXKWVIFSA-N |
| XLogP | 3.82 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|