C13H17F3N4O — CID 38559713
3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide (PubChem CID 38559713) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is 3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide.
| Compound Name | 3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 38559713 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propanamide |
| SMILES | NC(=O)CCN1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C13H17F3N4O/c14-13(15,16)10-1-2-12(18-9-10)20-7-5-19(6-8-20)4-3-11(17)21/h1-2,9H,3-8H2,(H2,17,21) |
| InChIKey | DZFUTSRFVLVWCW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |