C18H25F3N4O — CID 78788182
1-(azepan-1-yl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 78788182) has the molecular formula C18H25F3N4O and a molecular weight of 370.42 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 78788182 |
| Molecular Formula | C18H25F3N4O |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(c2ccc(C(F)(F)F)cn2)CC1)N1CCCCCC1 |
| InChI | InChI=1S/C18H25F3N4O/c19-18(20,21)15-5-6-16(22-13-15)24-11-9-23(10-12-24)14-17(26)25-7-3-1-2-4-8-25/h5-6,13H,1-4,7-12,14H2 |
| InChIKey | AJOZQGMAMORUAR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |