C19H23F3N6 — CID 165433334
3-piperidin-1-yl-6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridazine (PubChem CID 165433334) has the molecular formula C19H23F3N6 and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-piperidin-1-yl-6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridazine.
| Compound Name | 3-piperidin-1-yl-6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridazine |
|---|---|
| PubChem CID | 165433334 |
| Molecular Formula | C19H23F3N6 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 3-piperidin-1-yl-6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridazine |
| SMILES | FC(F)(F)c1ccc(N2CCN(c3ccc(N4CCCCC4)nn3)CC2)nc1 |
| InChI | InChI=1S/C19H23F3N6/c20-19(21,22)15-4-5-16(23-14-15)27-10-12-28(13-11-27)18-7-6-17(24-25-18)26-8-2-1-3-9-26/h4-7,14H,1-3,8-13H2 |
| InChIKey | BWXKKAPBLUPXTO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 48.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |