C11H15F3N3+ — CID 28873857
[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]azanium (PubChem CID 28873857) has the molecular formula C11H15F3N3+ and a molecular weight of 246.26 g/mol. Its IUPAC name is [1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]azanium.
| Compound Name | [1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]azanium |
|---|---|
| PubChem CID | 28873857 |
| Molecular Formula | C11H15F3N3+ |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | [1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]azanium |
| SMILES | [NH3+]C1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C11H14F3N3/c12-11(13,14)8-1-2-10(16-7-8)17-5-3-9(15)4-6-17/h1-2,7,9H,3-6,15H2/p+1 |
| InChIKey | DAVHQAOEZPKBPV-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 43.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |