C15H20F3N3 — CID 62592662
N-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methyl]cyclopropanamine (PubChem CID 62592662) has the molecular formula C15H20F3N3 and a molecular weight of 299.34 g/mol. Its IUPAC name is N-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62592662 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-[[1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)c1ccc(N2CCC(CNC3CC3)CC2)nc1 |
| InChI | InChI=1S/C15H20F3N3/c16-15(17,18)12-1-4-14(20-10-12)21-7-5-11(6-8-21)9-19-13-2-3-13/h1,4,10-11,13,19H,2-3,5-9H2 |
| InChIKey | IGIWMIMPAVAYPM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |