C15H20F3N3S — CID 97194477
N-[(3S)-thiolan-3-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-amine (PubChem CID 97194477) has the molecular formula C15H20F3N3S and a molecular weight of 331.41 g/mol. Its IUPAC name is N-[(3S)-thiolan-3-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-amine.
| Compound Name | N-[(3S)-thiolan-3-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-amine |
|---|---|
| PubChem CID | 97194477 |
| Molecular Formula | C15H20F3N3S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[(3S)-thiolan-3-yl]-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-amine |
| SMILES | FC(F)(F)c1ccc(N2CCC(N[C@H]3CCSC3)CC2)nc1 |
| InChI | InChI=1S/C15H20F3N3S/c16-15(17,18)11-1-2-14(19-9-11)21-6-3-12(4-7-21)20-13-5-8-22-10-13/h1-2,9,12-13,20H,3-8,10H2/t13-/m0/s1 |
| InChIKey | LWAPIXQARTVBDG-ZDUSSCGKSA-N |
| XLogP | 3.16 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |