C14H17F4N3 — CID 77463574
N-cyclopropyl-3-fluoro-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-amine (PubChem CID 77463574) has the molecular formula C14H17F4N3 and a molecular weight of 303.30 g/mol. Its IUPAC name is N-cyclopropyl-3-fluoro-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-amine.
| Compound Name | N-cyclopropyl-3-fluoro-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-amine |
|---|---|
| PubChem CID | 77463574 |
| Molecular Formula | C14H17F4N3 |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-cyclopropyl-3-fluoro-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-amine |
| SMILES | FC1CN(c2ccc(C(F)(F)F)cn2)CCC1NC1CC1 |
| InChI | InChI=1S/C14H17F4N3/c15-11-8-21(6-5-12(11)20-10-2-3-10)13-4-1-9(7-19-13)14(16,17)18/h1,4,7,10-12,20H,2-3,5-6,8H2 |
| InChIKey | MWZRYEUNMSYBSA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |