C15H16F3N5 — CID 2741603
6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridin-3-amine (PubChem CID 2741603) has the molecular formula C15H16F3N5 and a molecular weight of 323.32 g/mol. Its IUPAC name is 6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridin-3-amine.
| Compound Name | 6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 2741603 |
| Molecular Formula | C15H16F3N5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 6-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CCN(c3ccc(C(F)(F)F)cn3)CC2)nc1 |
| InChI | InChI=1S/C15H16F3N5/c16-15(17,18)11-1-3-13(20-9-11)22-5-7-23(8-6-22)14-4-2-12(19)10-21-14/h1-4,9-10H,5-8,19H2 |
| InChIKey | QDZTWUCBEGLQEP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |