C15H14ClF3N4 — CID 133352551
1-(3-chloro-4-pyridinyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 133352551) has the molecular formula C15H14ClF3N4 and a molecular weight of 342.75 g/mol. Its IUPAC name is 1-(3-chloro-4-pyridinyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-(3-chloro-4-pyridinyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 133352551 |
| Molecular Formula | C15H14ClF3N4 |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(3-chloro-4-pyridinyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | FC(F)(F)c1ccc(N2CCN(c3ccncc3Cl)CC2)nc1 |
| InChI | InChI=1S/C15H14ClF3N4/c16-12-10-20-4-3-13(12)22-5-7-23(8-6-22)14-2-1-11(9-21-14)15(17,18)19/h1-4,9-10H,5-8H2 |
| InChIKey | UHRBDJGZIMHIBT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |