C21H21F3N5+ — CID 162561436
1-(3,4-dimethyl-5-pyridin-4-ylpyrrol-1-ium-2-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 162561436) has the molecular formula C21H21F3N5+ and a molecular weight of 400.43 g/mol. Its IUPAC name is 1-(3,4-dimethyl-5-pyridin-4-ylpyrrol-1-ium-2-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-(3,4-dimethyl-5-pyridin-4-ylpyrrol-1-ium-2-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 162561436 |
| Molecular Formula | C21H21F3N5+ |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-(3,4-dimethyl-5-pyridin-4-ylpyrrol-1-ium-2-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | CC1=C(C)C(N2CCN(c3ccc(C(F)(F)F)cn3)CC2)=[N+]=C1c1ccncc1 |
| InChI | InChI=1S/C21H21F3N5/c1-14-15(2)20(27-19(14)16-5-7-25-8-6-16)29-11-9-28(10-12-29)18-4-3-17(13-26-18)21(22,23)24/h3-8,13H,9-12H2,1-2H3/q+1 |
| InChIKey | FYJFFKJINSNJSA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|