C11H14F3N3 — CID 829355
1-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 829355) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is 1-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 829355 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-methyl-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | CN1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C11H14F3N3/c1-16-4-6-17(7-5-16)10-3-2-9(8-15-10)11(12,13)14/h2-3,8H,4-7H2,1H3 |
| InChIKey | BOIFDXWRPSEUMD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |