C15H17ClF3N5 — CID 26601789
1-[(5-chloro-1-methylimidazol-2-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 26601789) has the molecular formula C15H17ClF3N5 and a molecular weight of 359.78 g/mol. Its IUPAC name is 1-[(5-chloro-1-methylimidazol-2-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[(5-chloro-1-methylimidazol-2-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 26601789 |
| Molecular Formula | C15H17ClF3N5 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 1-[(5-chloro-1-methylimidazol-2-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | Cn1c(Cl)cnc1CN1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C15H17ClF3N5/c1-22-12(16)9-21-14(22)10-23-4-6-24(7-5-23)13-3-2-11(8-20-13)15(17,18)19/h2-3,8-9H,4-7,10H2,1H3 |
| InChIKey | KQGFMESPDBSJOC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |