C17H16BrF4N3 — CID 55354194
1-[(4-bromo-2-fluorophenyl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 55354194) has the molecular formula C17H16BrF4N3 and a molecular weight of 418.23 g/mol. Its IUPAC name is 1-[(4-bromo-2-fluorophenyl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[(4-bromo-2-fluorophenyl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 55354194 |
| Molecular Formula | C17H16BrF4N3 |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 1-[(4-bromo-2-fluorophenyl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | Fc1cc(Br)ccc1CN1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H16BrF4N3/c18-14-3-1-12(15(19)9-14)11-24-5-7-25(8-6-24)16-4-2-13(10-23-16)17(20,21)22/h1-4,9-10H,5-8,11H2 |
| InChIKey | OLQDPPFBOUDQOR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |